| Name |
Erginine Isolysergic acid amide |
| Formula |
C16H17N3O |
| Mw |
267.13716219 |
| CAS RN |
2889-26-1 |
| C_ID |
C00011203
, 
|
| InChIKey |
GENAHGKEFJLNJB-MOVNSBPVNA-N |
| InChICode |
InChI=1S/C16H17N3O/c1-19-8-10(16(17)20)5-12-11-3-2-4-13-15(11)9(7-18-13)6-14(12)19/h2-5,7,10,14,18H,6,8H2,1H3,(H2,17,20)/t10-,14+/m0/s1 |
| SMILES |
CN1C[C@@H](C(N)=O)C=C2c3cccc4[nH]cc(c34)C[C@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp IPP |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Clavicipitaceae | Claviceps purpurea  | Ref. |
| Plantae | Convolvulaceae | Ipomoea asarifolia  | Ref. |
| Plantae | Convolvulaceae | Ipomoea corymbosa | Ref. |
| Plantae | Convolvulaceae | Ipomoea violacea | Ref. |
|
|
zoom in
| Organism | Claviceps purpurea | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003),Indole Alkaloids
Berde,Handbook of Experimental Pharmacology,Springer-Verlag New York,(1978) |
|---|
|