| Name |
Erythrabyssin II 3,9-Dihydroxy-2,10-diprenylpterocarpan |
| Formula |
C25H28O4 |
| Mw |
392.19875938 |
| CAS RN |
77263-06-0 |
| C_ID |
C00009669
, 
|
| InChIKey |
LDKAMVCGTURXMH-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H28O4/c1-14(2)5-7-16-11-19-23(12-22(16)27)28-13-20-17-9-10-21(26)18(8-6-15(3)4)24(17)29-25(19)20/h5-6,9-12,20,25-27H,7-8,13H2,1-4H3/t20-,25-/m0/s1 |
| SMILES |
CC(C)=CCc1cc2c(cc1O)OCC1c3ccc(O)c(CC=C(C)C)c3OC21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina abyssinica  | Ref. |
| Plantae | Fabaceae | Erythrina burttii | Ref. |
| Plantae | Fabaceae | Erythrina orientalis | Ref. |
| Plantae | Fabaceae | Erythrina poeppigiana  | Ref. |
| Plantae | Fabaceae | Erythrina sigmoidea | Ref. |
| Plantae | Fabaceae | Erythrina suberosa var. glabrescences  | Ref. |
| Plantae | Fabaceae | Erythrina subumbrans | Ref. |
| Plantae | Fabaceae | Erythrina variegata  | Ref. |
| Plantae | Fabaceae | Erythrina x bidwillii | Ref. |
| Plantae | Fabaceae | Erythrina zeyheri | Ref. |
| Plantae | Fabaceae | Lespedeza floribunda | Ref. |
| Plantae | Fabaceae | Phaseolus lunatus  | Ref. |
| Plantae | Fabaceae | Sophora prostrata | Ref. |
|
|
zoom in
| Organism | Erythrina abyssinica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Kamat,Heterocycles,15,(1981),1163 |
|---|
|