| Name |
4',6,7-Trihydroxyisoflavone Demethyltexasin 6-Hydroxydaidzein |
| Formula |
C15H10O5 |
| Mw |
270.05282343 |
| CAS RN |
17817-31-1 |
| C_ID |
C00009385
, 
|
| InChIKey |
GYLUFQJZYAJQDI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-14-6-13(18)12(17)5-10(14)15(11)19/h1-7,16-18H |
| SMILES |
O=c1c(-c2ccc(O)cc2)coc2cc(O)c(O)cc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Centrosema haitiense | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
|
|
zoom in
| Organism | Centrosema haitiense | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Markham,Z.Naturforsch.C.,35,(1980),919 |
|---|
|