| Name |
Neoisoliquiritigenin Neoisoliquiritin |
| Formula |
C21H22O9 |
| Mw |
418.1263823 |
| CAS RN |
59122-93-9 |
| C_ID |
C00007185
, 
|
| InChIKey |
XQWFHGOIUZFQPJ-RCWMLILLNA-N |
| InChICode |
InChI=1S/C21H22O9/c22-10-17-18(26)19(27)20(28)21(30-17)29-13-6-7-14(16(25)9-13)15(24)8-3-11-1-4-12(23)5-2-11/h1-9,17-23,25-28H,10H2/b8-3+/t17-,18+,19-,20+,21+/m0/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)c1ccc(O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Dahlia variabilis  | Ref. |
| Plantae | Asteraceae | Viguiera spp. | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Spatholobus suberectus Dunn  | Ref. |
| Plantae | Fabaceae | Ulex europaeus  | Ref. |
|
|
zoom in
| Organism | Dahlia variabilis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Nordstrom,Arch.Biochem.Biophys.,60,(1956),329
Harborne,Phytochem.,1,(1962),203 |
|---|
|