| Name |
Saponarin |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
20310-89-8 |
| C_ID |
C00006224
, 
|
| InChIKey |
HGUVPEBGCAVWID-ALWFZJRANA-N |
| InChICode |
InChI=1S/C27H30O15/c28-7-15-19(32)22(35)24(37)26(40-15)18-14(41-27-25(38)23(36)20(33)16(8-29)42-27)6-13-17(21(18)34)11(31)5-12(39-13)9-1-3-10(30)4-2-9/h1-6,15-16,19-20,22-30,32-38H,7-8H2/t15-,16-,19-,20-,22+,23+,24-,25-,26+,27-/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Caryophyllaceae | Saponaria officinalis  | Ref. |
| Plantae | Cucurbitaceae | Bryonia dioica  | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
| Plantae | Fabaceae | Lespedeza juncea | Ref. |
| Plantae | Gentianaceae | Gentiana algida | Ref. |
| Plantae | Gentianaceae | Gentiana decumbens | Ref. |
| Plantae | Gentianaceae | Gentiana decumbers | Ref. |
| Plantae | Gentianaceae | Gentiana macrophylla  | Ref. |
| Plantae | Gentianaceae | Gentiana piasezkii | Ref. |
| Plantae | Gentianaceae | Gentiana triflora | Ref. |
| Plantae | Malvaceae | Hibiscus syriacus  | Ref. |
| Plantae | Passifloraceae | Passiflora incarnata  | Ref. |
| Plantae | Poaceae | Arrhenatherum sp. | Ref. |
| - | - | Mnium cuspidatum | Ref. |
|
|
zoom in
| Organism | Saponaria officinalis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Barger,J.Chem.Soc.,89,(1906),1210
Horhammer,Tetrahedron Lett.,(1965),1707 |
|---|
|