| Name |
Kaempferol 5-glucoside |
| Formula |
C21H20O11 |
| Mw |
448.10056148 |
| CAS RN |
34157-80-7 |
| C_ID |
C00005143
, 
|
| InChIKey |
ZSDLSQASILNAAH-YHAOOQQVNA-N |
| InChICode |
InChI=1S/C21H20O11/c22-7-13-15(25)17(27)19(29)21(32-13)31-12-6-10(24)5-11-14(12)16(26)18(28)20(30-11)8-1-3-9(23)4-2-8/h1-6,13,15,17,19,21-25,27-29H,7H2/t13-,15+,17-,19+,21+/m0/s1 |
| SMILES |
O=c1c(O)c(-c2ccc(O)cc2)oc2cc(O)cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Cotula goughensis | Ref. |
| Plantae | Dennstaedtiaceae | Pteridium aquilinum  | Ref. |
| Plantae | Malvaceae | Thespesia populnea  | Ref. |
|
|
zoom in
| Organism | Cotula goughensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Glennie, Phytochem.,10(,(1971),1325
Wij,Indian J.Chem.Sect.B,16,(1978),644 |
|---|
|