| Name |
Quercetagetin 3,7,3',4'-tetramethyl ether 5,6-Dihydroxy-3,3',4',7-tetramethoxyflavone |
| Formula |
C19H18O8 |
| Mw |
374.10016755 |
| CAS RN |
63296-15-1 |
| C_ID |
C00004707
, 
|
| InChIKey |
DXEKSOHHLFZGKA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O8/c1-23-10-6-5-9(7-11(10)24-2)18-19(26-4)17(22)14-12(27-18)8-13(25-3)15(20)16(14)21/h5-8,20-21H,1-4H3 |
| SMILES |
COc1ccc(-c2oc3cc(OC)c(O)c(O)c3c(=O)c2OC)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Brickellia cylindracea | Ref. |
| Plantae | Asteraceae | Pulicaria dysenterica  | Ref. |
| Plantae | Fabaceae | Distemonanthus benthamianus  | Ref. |
|
|
zoom in
| Organism | Brickellia cylindracea | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Malan,J.Chem.Soc.Parkin Trans.,1,(1979),2696 |
|---|
|