| Name |
5,7,3'-Trihydroxy-4'-methoxyflavone 7-O-rutinoside Diosmin Luteolin 4'-methyl ether 7-rutinoside |
| Formula |
C28H32O15 |
| Mw |
608.17412036 |
| CAS RN |
520-27-4 |
| C_ID |
C00004362
, 
|
| InChIKey |
GZSOSUNBTXMUFQ-GLOFBDNXNA-N |
| InChICode |
InChI=1S/C28H32O15/c1-10-21(32)23(34)25(36)27(40-10)39-9-19-22(33)24(35)26(37)28(43-19)41-12-6-14(30)20-15(31)8-17(42-18(20)7-12)11-3-4-16(38-2)13(29)5-11/h3-8,10,19,21-30,32-37H,9H2,1-2H3/t10-,19+,21-,22+,23-,24-,25+,26+,27+,28+/m0/s1 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O[C@@H]4OC(CO[C@@H]5OC(C)[C@H](O)[C@H](O)C5O)[C@@H](O)[C@H](O)C4O)cc3o2)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Dahlia variabilis  | Ref. |
| Plantae | Caryophyllaceae | Pratia nummularia | Ref. |
| Plantae | Crassulaceae | Bryophyllum pinnatum  | Ref. |
| Plantae | Fabaceae | Sophora davidii | Ref. |
| Plantae | Fabaceae | Sophora microphylla  | Ref. |
| Plantae | Fabaceae | Vicia cracca  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Diosma crenulata | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
|
|
zoom in
| Organism | Dahlia variabilis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Nakaoki,J.Pharm.Soc.,58,(1938),539
Tomas,Proc.Int.Soc.Citric,(1978),74 |
|---|
|