| Name |
Cucurbitacin A |
| Formula |
C32H46O9 |
| Mw |
574.31418307 |
| CAS RN |
6040-19-3 |
| C_ID |
C00003682
, 
|
| InChIKey |
IHTCCHVMPGDDSL-JEWXSFAPNA-N |
| InChICode |
InChI=1S/C32H46O9/c1-17(34)41-27(2,3)12-11-23(37)31(8,40)25-21(36)14-29(6)22-10-9-18-19(13-20(35)26(39)28(18,4)5)32(22,16-33)24(38)15-30(25,29)7/h9,11-12,19-22,25,33,35-36,40H,10,13-16H2,1-8H3/b12-11+/t19-,20+,21-,22+,25+,29+,30-,31+,32+/m1/s1 |
| SMILES |
CC(=O)OC(C)(C)/C=C/C(=O)[C@](C)(O)[C@H]1[C@H](O)C[C@@]2(C)[C@@H]3CC=C4[C@@H](C[C@H](O)C(=O)C4(C)C)[C@]3(CO)C(=O)C[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cucurbitaceae | Citrullus colocynthis  | Ref. |
| Plantae | Cucurbitaceae | Cucumis hookeri | Ref. |
| Plantae | Cucurbitaceae | Cucumis leptodermis | Ref. |
| Plantae | Cucurbitaceae | Cucumis melo | Ref. |
| Plantae | Cucurbitaceae | Cucumis myriocarpus | Ref. |
| Plantae | Plantaginaceae | Gratiola officinalis | Ref. |
|
|
zoom in
| Organism | Citrullus colocynthis |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
