| Name |
Spinasterol
alpha-Spinasterin
alpha-Spinasterol
(-)-Spinasterol |
| Formula |
C29H48O |
| Mw |
412.37051615 |
| CAS RN |
481-18-5 |
| C_ID |
C00003673
, 
|
| InChIKey |
JZVFJDZBLUFKCA-BIZAHVARNA-N |
| InChICode |
InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-9,11,19-23,25-27,30H,7,10,12-18H2,1-6H3/b9-8+/t20-,21+,22-,23-,25+,26-,27-,28-,29+/m0/s1 |
| SMILES |
CC[C@H](/C=C/[C@@H](C)[C@H]1CC[C@H]2C3=CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Achyranthes aspera  | Ref. |
| Plantae | Amaranthaceae | Achyranthes bidentata | Ref. |
| Plantae | Apiaceae | Bupleurum aureum | Ref. |
| Plantae | Apiaceae | Bupleurum chinense | Ref. |
| Plantae | Apiaceae | Bupleurum longiradiatum | Ref. |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Aster scaber | Ref. |
| Plantae | Asteraceae | Conyza blinii | Ref. |
| Plantae | Asteraceae | Eupatorium macrocephalum Lee. | Ref. |
| Plantae | Balsaminaceae | Impatiens siculifer | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Platycodon grandiflorum | Ref. |
| Plantae | Caryophyllaceae | Drymaria cordata | Ref. |
| Plantae | Caryophyllaceae | Gypsophila struthium | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cucurbitaceae | Citrullus colocynthis | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus | Ref. |
| Plantae | Cucurbitaceae | Luffa cylindrica | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes cucumeroides | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes kirilowii | Ref. |
| Plantae | Ericaceae | Kalmia latifolia L. | Ref. |
| Plantae | Fabaceae | Medicago sativa | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba L. | Ref. |
| Plantae | Hydrocharitaceae | Vallisneria spiralis | Ref. |
| Plantae | Malvaceae | Hibiscus sabdariffa L. | Ref. |
| Plantae | Menyanthaceae | Menyanthes trifoliata | Ref. |
| Plantae | Myrsinaceae | Embelia parviflora | Ref. |
| Plantae | Palmae | Cocos nucifera | Ref. |
| Plantae | Papaveraceae | Chelidonium ambrosioides | Ref. |
| Plantae | Papaveraceae | Chelidonium majus | Ref. |
| Plantae | Phytolaccaceae | Phytolacca americana | Ref. |
| Plantae | Polygalaceae | Polygala senega | Ref. |
| Plantae | Scrophulariaceae | Scrophularia takesimensis | Ref. |
| Plantae | Verbenaceae | Clerodendron serratum | Ref. |
|
|
zoom in
| Organism | Achyranthes aspera |
|---|
| Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
