| Name |
Meteloidine |
| Formula |
C13H21NO4 |
| Mw |
255.14705817 |
| CAS RN |
526-13-6 |
| C_ID |
C00002296
, 
|
| InChIKey |
YZFJTFVPCWEPND-IDIJEBNFNA-N |
| InChICode |
InChI=1S/C13H21NO4/c1-4-7(2)13(17)18-8-5-9-11(15)12(16)10(6-8)14(9)3/h4,8-12,15-16H,5-6H2,1-3H3/b7-4+/t8-,9-,10+,11-,12-/m1/s1 |
| SMILES |
C/C=C(C)C(=O)O[C@H]1CC2C(O)[C@H](O)[C@H](C1)N2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Erythroxylaceae | Erythroxylum australe | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum spp. | Ref. |
| Plantae | Solanaceae | Anthocercis spp. | Ref. |
| Plantae | Solanaceae | Datura candida  | Ref. |
| Plantae | Solanaceae | Datura ferox  | Ref. |
| Plantae | Solanaceae | Datura innoxia  | Ref. |
| Plantae | Solanaceae | Datura metaloides | Ref. |
| Plantae | Solanaceae | Datura meteloides | Ref. |
| Plantae | Solanaceae | Datura stramonium x D.discolor  | Ref. |
| - | - | Erythroxylon australe | Ref. |
|
|
zoom in
| Organism | Erythroxylum australe | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|