| Name |
Rutaecarpine Rutecarpine |
| Formula |
C18H13N3O |
| Mw |
287.10586206 |
| CAS RN |
84-26-4 |
| C_ID |
C00001766
, 
|
| InChIKey |
ACVGWSKVRYFWRP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H13N3O/c22-18-13-6-2-4-8-15(13)20-17-16-12(9-10-21(17)18)11-5-1-3-7-14(11)19-16/h1-8,19H,9-10H2 |
| SMILES |
O=c1c2ccccc2nc2n1CCc1c-2[nH]c2ccccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Rutaceae | Bouchardatia neurococca | Ref. |
| Plantae | Rutaceae | Evodia baberi | Ref. |
| Plantae | Rutaceae | Evodia rutaecarpa  | Ref. |
| Plantae | Rutaceae | Fagara rhetza (Roxb.) DC  | Ref. |
| Plantae | Rutaceae | Hortia arborea | Ref. |
| Plantae | Rutaceae | Hortia badinii | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
| Plantae | Rutaceae | Zanthoxylum integrifoliolum | Ref. |
| Plantae | Rutaceae | Zanthoxylum wutaiense | Ref. |
|
|
zoom in
| Organism | Corydalis yanhusuo | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|