| Name |
Evodiamine |
| Formula |
C19H17N3O |
| Mw |
303.13716219 |
| CAS RN |
518-17-2 |
| C_ID |
C00001727
, 
|
| InChIKey |
TXDUTHBFYKGSAH-LGWFVXIRNA-N |
| InChICode |
InChI=1S/C19H17N3O/c1-21-16-9-5-3-7-14(16)19(23)22-11-10-13-12-6-2-4-8-15(12)20-17(13)18(21)22/h2-9,18,20H,10-11H2,1H3/t18-/m0/s1 |
| SMILES |
CN1c2ccccc2C(=O)N2CCc3c([nH]c4ccccc34)[C@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Rutaceae | Araliopsis tabouensis | Ref. |
| Plantae | Rutaceae | Evodia rutaecarpa | Ref. |
| Plantae | Rutaceae | Fagara rhetza (Roxb.) DC | Ref. |
| Plantae | Rutaceae | Phellodendron amurense | Ref. |
|
|
zoom in
| Organism | Corydalis yanhusuo |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
