| Name |
Lotaustralin (R)-Lotaustralin |
| Formula |
C11H19NO6 |
| Mw |
261.12123735 |
| CAS RN |
534-67-8 |
| C_ID |
C00001448
, 
|
| InChIKey |
WEWBWVMTOYUPHH-TUJJETTJNA-N |
| InChICode |
InChI=1S/C11H19NO6/c1-3-11(2,5-12)18-10-9(16)8(15)7(14)6(4-13)17-10/h6-10,13-16H,3-4H2,1-2H3/t6-,7+,8-,9-,10-,11+/m0/s1 |
| SMILES |
CC[C@](C)(C#N)O[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Rhodiola kirilowii | Ref. |
| Plantae | Crassulaceae | Rhodiola sachalinensis  | Ref. |
| Plantae | Fabaceae | Acacia aroma  | Ref. |
| Plantae | Fabaceae | Dorycnium spp. | Ref. |
| Plantae | Fabaceae | Lotus arabicus | Ref. |
| Plantae | Fabaceae | Lotus arenarius | Ref. |
| Plantae | Fabaceae | Lotus australis | Ref. |
| Plantae | Fabaceae | Lotus conjugatus | Ref. |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Fabaceae | Lotus edulis  | Ref. |
| Plantae | Fabaceae | Lotus glaber | Ref. |
| Plantae | Fabaceae | Lotus krylovii | Ref. |
| Plantae | Fabaceae | Lotus maroccanus | Ref. |
| Plantae | Fabaceae | Lotus ornithopodioides | Ref. |
| Plantae | Fabaceae | Lotus parviflorus | Ref. |
| Plantae | Fabaceae | Lotus tetragonolobus  | Ref. |
| Plantae | Fabaceae | Ornithopus perpusillus | Ref. |
| Plantae | Fabaceae | Ornithopus pinnatus | Ref. |
| Plantae | Fabaceae | Trifolium nigrescens | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Haloragaceae | Haloragis erecta  | Ref. |
| Plantae | Linaceae | Linum usitatissimum  | Ref. |
| Plantae | Passifloraceae | Passiflora adenopoda DC. | Ref. |
| Plantae | Passifloraceae | Passiflora lutea L.  | Ref. |
| Plantae | Passifloraceae | Passiflora morifolia Mast. | Ref. |
| Plantae | Passifloraceae | Passiflora pendens MacDougal | Ref. |
| Plantae | Passifloraceae | Passiflora spp. | Ref. |
| Plantae | Poaceae | Triticum monococcum  | Ref. |
| - | - | Ornithopus | Ref. |
| - | - | Tetragonolobus spp. | Ref. |
|
|
zoom in
| Organism | Rhodiola kirilowii | | Reference | Peng, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 19, (1994), 676.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|