| Name |
Linamarin |
| Formula |
C10H17NO6 |
| Mw |
247.10558728 |
| CAS RN |
554-35-8 |
| C_ID |
C00001446
, 
|
| InChIKey |
QLTCHMYAEJEXBT-HLCICVDFNA-N |
| InChICode |
InChI=1S/C10H17NO6/c1-10(2,4-11)17-9-8(15)7(14)6(13)5(3-12)16-9/h5-9,12-15H,3H2,1-2H3/t5-,6-,7+,8-,9+/m1/s1 |
| SMILES |
CC(C)(C#N)O[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-His Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Manihot esculenta  | Ref. |
| Plantae | Euphorbiaceae | Manihot utilissimus | Ref. |
| Plantae | Fabaceae | Acacia aroma  | Ref. |
| Plantae | Fabaceae | Lotus arabicus | Ref. |
| Plantae | Fabaceae | Lotus arenarius | Ref. |
| Plantae | Fabaceae | Lotus conjugatus | Ref. |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Fabaceae | Lotus creticus | Ref. |
| Plantae | Fabaceae | Lotus edulis  | Ref. |
| Plantae | Fabaceae | Lotus glaber | Ref. |
| Plantae | Fabaceae | Lotus krylovii | Ref. |
| Plantae | Fabaceae | Lotus maroccanus | Ref. |
| Plantae | Fabaceae | Lotus ornithopodioides | Ref. |
| Plantae | Fabaceae | Lotus parviflorus | Ref. |
| Plantae | Fabaceae | Lotus tetragonolobus  | Ref. |
| Plantae | Fabaceae | Ornithopus perpusillus | Ref. |
| Plantae | Fabaceae | Ornithopus pinnatus | Ref. |
| Plantae | Fabaceae | Phaseolus lunatus  | Ref. |
| Plantae | Fabaceae | Trifolium nigrescens | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Linaceae | Linum usitatissimum  | Ref. |
| Plantae | Passifloraceae | Passiflora adenopoda DC. | Ref. |
| Plantae | Passifloraceae | Passiflora foetida L.  | Ref. |
| Plantae | Passifloraceae | Passiflora lutea L.  | Ref. |
| Plantae | Passifloraceae | Passiflora morifolia Mast. | Ref. |
| Plantae | Passifloraceae | Passiflora pendens MacDougal | Ref. |
| Plantae | Passifloraceae | Passiflora spp. | Ref. |
| Plantae | Passifloraceae | Passiflora warmingii | Ref. |
|
|
zoom in
| Organism | Manihot esculenta | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Wang, et al., Dictionary of Medicinal Plants, Tianjin Science and technology Press, Tianjin, (2005) |
|---|
|