| Name |
Swertiajaponin
Leucanthoside
6-beta-D-glucopyranosyl-3',4',5-trihydroxy-7-methoxyflavone |
| Formula |
C22H22O11 |
| Mw |
462.11621155 |
| CAS RN |
6980-25-2 |
| C_ID |
C00001102
, 
|
| InChIKey |
DLVLXOYLQKCAME-FPRNEBIWNA-N |
| InChICode |
InChI=1S/C22H22O11/c1-31-13-6-14-16(11(26)5-12(32-14)8-2-3-9(24)10(25)4-8)19(28)17(13)22-21(30)20(29)18(27)15(7-23)33-22/h2-6,15,18,20-25,27-30H,7H2,1H3/t15-,18-,20+,21-,22+/m1/s1 |
| SMILES |
COc1cc2oc(-c3ccc(O)c(O)c3)cc(=O)c2c(O)c1[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea leptophylla | Ref. |
| Plantae | Asteraceae | Achillea spp. | Ref. |
| Plantae | Asteraceae | Tragopogon spp. | Ref. |
| Plantae | Dipsacaceae | Cephalaria leucantha | Ref. |
| Plantae | Dipsacaceae | Cephalaria uralensis | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Knautia montana | Ref. |
| Plantae | Gentianaceae | Gentiana germanica | Ref. |
| Plantae | Gentianaceae | Gentiana ramosa | Ref. |
| Plantae | Gentianaceae | Swertia japonica  | Ref. |
| Plantae | Gentianaceae | Swertia mileensis | Ref. |
| Plantae | Gnetaceae | Gnetum gnemon | Ref. |
| Plantae | Iridaceae | Iris germanica | Ref. |
| Plantae | Iridaceae | Iris nertshinskia | Ref. |
| Plantae | Iridaceae | Iris ramosa | Ref. |
| Plantae | Iridaceae | Iris sanguinea | Ref. |
| Plantae | Poaceae | Cymbopogon citratus | Ref. |
| Plantae | Poaceae | Deschampsia antarctica | Ref. |
| - | - | Pterocephalus plumosus | Ref. |
|
|
zoom in
| Organism | Achillea leptophylla |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003) |
|---|
|
