| Name |
Justicidin B |
| Formula |
C21H16O6 |
| Mw |
364.09468824 |
| CAS RN |
17951-19-8 |
| C_ID |
C00000701
, 
|
| InChIKey |
RTDRYYULUYRTAN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H16O6/c1-23-16-7-12-5-13-9-25-21(22)20(13)19(14(12)8-17(16)24-2)11-3-4-15-18(6-11)27-10-26-15/h3-8H,9-10H2,1-2H3 |
| SMILES |
COc1cc2cc3c(c(-c4ccc5c(c4)OCO5)c2cc1OC)C(=O)OC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Hypoestes purpurea | Ref. |
| Plantae | Acanthaceae | Justicia hayatai var.decumbens | Ref. |
| Plantae | Acanthaceae | Justicia hayati | Ref. |
| Plantae | Acanthaceae | Justicia pectoralis  | Ref. |
| Plantae | Acanthaceae | Justicia procumbens  | Ref. |
| Plantae | Acanthaceae | Justicia procumbens L. var. leucantha  | Ref. |
| Plantae | Fabaceae | Sesbania drummondii | Ref. |
| Plantae | Linaceae | Linum austriacum | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus acuminatus  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus anisolobus | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus myrtifolius | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus piscatorum | Ref. |
| Plantae | Rutaceae | Boenninghausenia albiflora  | Ref. |
| Plantae | Rutaceae | Haplophyllum bucharicum | Ref. |
| Plantae | Rutaceae | Haplophyllum buxbaumii | Ref. |
| Plantae | Rutaceae | Haplophyllum cappadocicum | Ref. |
| Plantae | Rutaceae | Haplophyllum dauricum | Ref. |
| Plantae | Rutaceae | Haplophyllum obtusifolium | Ref. |
| Plantae | Rutaceae | Haplophyllum patavinum | Ref. |
| Plantae | Rutaceae | Haplophyllum popovii | Ref. |
| Plantae | Rutaceae | Haplophyllum tuberculatum  | Ref. |
| - | - | Rostellularia procumbens | Ref. |
|
|
zoom in
| Organism | Hypoestes purpurea | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Asano, et al., Phytochemistry, 42, (1996), 713.
Joseph, et al., Journal of Natural Products, 51, (1988), 599.
Hui, et al., Journal of Natural Products, 49, (1986), 1175.
MacRae, et al., Planta Med, 55, (1989), 531.
INNOCENTI, et al., Chem Pharm Bull, 50, (2002), 844.
Kavitha, et al., Journal of Natural Products, 66, (2003), 1113.
Gertsch, et al., Planta Med, 69, (2003), 420.
Karikome, Wen-ben Yang translated, Phytochemistry, Science Press, Beijing, (1985) |
|---|
|