| Name |
(+)-Secoisolariciresinol diglucoside |
| Formula |
C32H46O16 |
| Mw |
686.27858542 |
| CAS RN |
158932-33-3 |
| C_ID |
C00000652
, 
|
| InChIKey |
SBVBJPHMDABKJV-BMAXLOGHNA-N |
| InChICode |
InChI=1S/C32H46O16/c1-43-21-9-15(3-5-19(21)35)7-17(13-45-31-29(41)27(39)25(37)23(11-33)47-31)18(8-16-4-6-20(36)22(10-16)44-2)14-46-32-30(42)28(40)26(38)24(12-34)48-32/h3-6,9-10,17-18,23-42H,7-8,11-14H2,1-2H3/t17-,18-,23-,24+,25-,26-,27+,28+,29-,30-,31-,32-/m1/s1 |
| SMILES |
COc1cc(CC(CO[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)[C@@H](CO[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)Cc2ccc(O)c(OC)c2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Linaceae | Linum usitatissimum  | Ref. |
|
|
zoom in
| Organism | Linum usitatissimum | | Reference | Dord,Plant Polyphenols 2:Chemistry and Biology.Plenum.New York,(1999)
Adlercreutz,Progress in Cancer:Research and Therapy,35,(1988),409
Adlercreutz,Natural Antioxidants and Food Quality in Atherosclerosis and Cancer Prevention.Royal Society of Chemistry.Cambridge,(1996),p 349
Bakke,proc.No.Dakota Acad.Sci,10,(1956),18 |
|---|
|