| Name |
(+)-Marmesin Marmesin |
| Formula |
C14H14O4 |
| Mw |
246.08920894 |
| CAS RN |
13849-08-6 |
| C_ID |
C00000584
, 
|
| InChIKey |
FWYSBEAFFPBAQU-STGVRZAANA-N |
| InChICode |
InChI=1S/C14H14O4/c1-14(2,16)12-6-9-5-8-3-4-13(15)18-10(8)7-11(9)17-12/h3-5,7,12,16H,6H2,1-2H3/t12-/m0/s1 |
| SMILES |
CC(C)(O)[C@@H]1Cc2cc3ccc(=O)oc3cc2O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Ammi majus  | Ref. |
| Plantae | Apiaceae | Angelica dahurica  | Ref. |
| Plantae | Apiaceae | Angelica gigas  | Ref. |
| Plantae | Apiaceae | Angelica pachycarpa | Ref. |
| Plantae | Apiaceae | Arracacia xanthorrhiza  | Ref. |
| Plantae | Apiaceae | Cachrys buchorica | Ref. |
| Plantae | Apiaceae | Ferulago capillaris | Ref. |
| Plantae | Apiaceae | Heracleum candicans WALL.  | Ref. |
| Plantae | Apiaceae | Heracleum rapula | Ref. |
| Plantae | Apiaceae | Notopterygium incisum  | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Apiaceae | Peucedanum rubricaule | Ref. |
| Plantae | Apiaceae | Peucedanum terebinthaceum | Ref. |
| Plantae | Apiaceae | Pleurospermum rivulorum | Ref. |
| Plantae | Apiaceae | Prangos bucharica | Ref. |
| Plantae | Apiaceae | Prangos latiloba | Ref. |
| Plantae | Fabaceae | Tephrosia toxicaria | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
| Plantae | Moraceae | Broussonetia papyrigera | Ref. |
| Plantae | Moraceae | Ficus carica  | Ref. |
| Plantae | Moraceae | Ficus cunninghamii | Ref. |
| Plantae | Moraceae | Ficus eriobotryoides | Ref. |
| Plantae | Moraceae | Ficus sycomorus  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Poncirus trifoliata  | Ref. |
| Plantae | Rutaceae | Zanthoxylum arnottianum | Ref. |
| Plantae | Rutaceae | Zanthoxylum belizense | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
|
|
zoom in
| Organism | Ammi majus | | Reference | Matern,Cell Culture and Somatic Cell Genetics of Plants,Academic Press.New York,vol5,(1988),p3
Matern,Planta Med,57,(1991),S15 |
|---|
|