| Name |
2,6-Dimethoxy-1,4-benzoquinone 2,6-Dimethoxy-p-benzoquinone |
| Formula |
C8H8O4 |
| Mw |
168.04225874 |
| CAS RN |
530-55-2 |
| C_ID |
C00000258
, 
|
| InChIKey |
OLBNOBQOQZRLMP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H8O4/c1-11-6-3-5(9)4-7(12-2)8(6)10/h3-4H,1-2H3 |
| SMILES |
COC1=CC(=O)C=C(OC)C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes formosanus | Ref. |
| Plantae | Apocynaceae | Rauvolfia vomitoria  | Ref. |
| Plantae | Asteraceae | Chrysanthemum leucanthemum | Ref. |
| Plantae | Asteraceae | Helianthus heterophyllus | Ref. |
| Plantae | Ebenaceae | Diospyros eriantha | Ref. |
| Plantae | Fabaceae | Acacia melanoxylon R.Br.  | Ref. |
| Plantae | Fabaceae | Caesalpinia pulcherrima  | Ref. |
| Plantae | Juglandaceae | Engelhardia roxburghiana | Ref. |
| Plantae | Lauraceae | Neolitsea acuminatissima | Ref. |
| Plantae | Malvaceae | Durio kutejensis  | Ref. |
| Plantae | Orobanchaceae | Striga asiatica  | Ref. |
| Plantae | Poaceae | Phyllostachys heterocycla var.pubescens | Ref. |
| Plantae | Poaceae | Triticum vulgare | Ref. |
| Plantae | Ranunculaceae | Adonis vernalis  | Ref. |
| Plantae | Rutaceae | Fagara tessmannii Engl. | Ref. |
| Plantae | Rutaceae | Toddalia asiatica  | Ref. |
| Plantae | Salicaceae | Populus pseudosimonii | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
|
|
zoom in
| Organism | Strobilanthes formosanus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|