| Name |
Humilixanthin |
| Formula |
C14H18N2O7 |
| Mw |
326.11140095 |
| CAS RN |
111534-70-4 |
| C_ID |
C00001590
, 
|
| InChIKey |
RVPIQBBRHBAQKG-SIMSYMCXNA-N |
| InChICode |
InChI=1S/C14H18N2O7/c17-5-1-2-9(12(18)19)15-4-3-8-6-10(13(20)21)16-11(7-8)14(22)23/h3-4,6,9,11,16-17H,1-2,5,7H2,(H,18,19)(H,20,21)(H,22,23)/b8-3-,15-4+/t9-,11-/m0/s1 |
| SMILES |
O=C(O)C1=C/C(=C/C=N[C@@H](CCCO)C(=O)O)C[C@@H](C(=O)O)N1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Lys |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aizoaceae | Delosperma luteum | Ref. |
| Plantae | Aizoaceae | Lampranthus aurantiacus | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Phytolaccaceae | Phytolacca acinosa  | Ref. |
| Plantae | Portulacaceae/Montiaceae | Portulaca grandiflora  | Ref. |
| - | - | Iso. from the yellow-coloured root of beetroot | Ref. |
|
|
zoom in
|