Name |
cis-3-Hexenyl acetate (Z)-3-Hexenyl acetate |
Formula |
C8H14O2 |
Mw |
142.09937969 |
CAS RN |
3681-71-8 |
C_ID |
C00048964
, 
|
InChIKey |
NPFVOOAXDOBMCE-PLNGDYQASA-N |
InChICode |
InChI=1S/C8H14O2/c1-3-4-5-6-7-10-8(2)9/h4-5H,3,6-7H2,1-2H3/b5-4- |
SMILES |
CC/C=CCCOC(C)=O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Anacardium occidentale  | Ref. |
Plantae | Asteraceae | Matricaria recutita  | Ref. |
Plantae | Caricaceae | Carica papaya  | Ref. |
Plantae | Caryophyllaceae | Silene latifolia  | Ref. |
Plantae | Caryophyllales | Beta vulgaris  | Ref. |
Plantae | Cruciferae | Brassica rapa  | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
Plantae | Fabaceae | Medicago sativa  | Ref. |
Plantae | Labiatae | Perilla frutescens  | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Psidium guajava  | Ref. |
Plantae | Oleaceae | Olea europaea  | Ref. |
Plantae | Orchidaceae | Epipactis helleborine | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Rutaceae | Murraya paniculata  | Ref. |
Plantae | Scrophulariaceae | Scrophularia umbrosa  | Ref. |
Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
Plantae | Taxaceae | Taxus wallichiana  | Ref. |
Plantae | Theaceae | Camellia sinensis  | Ref. |
|
|
zoom in
Organism | Taxus wallichiana | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|