Name |
Cycloartanol |
Formula |
C30H52O |
Mw |
428.40181628 |
CAS RN |
4657-58-3 |
C_ID |
C00043423
, 
|
InChIKey |
XIWZWKZAOVPHOG-YBUZQLDBNA-N |
InChICode |
InChI=1S/C30H52O/c1-20(2)9-7-8-10-21(3)22-11-12-23-24-13-14-25-27(4,5)26(31)15-16-30(25)19-29(24,30)18-17-28(22,23)6/h20-26,31H,7-19H2,1-6H3/t21-,22-,23+,24+,25+,26+,28-,29+,30-/m1/s1 |
SMILES |
CC(C)CCCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C(C)(C)[C@@H](O)CC[C@@]45C[C@@]35CC[C@]12C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
Plantae | Asphodelaceae | Aloe sabaea | Ref. |
Plantae | Asphodelaceae | Aloe saponaria  | Ref. |
Plantae | Asphodelaceae | Aloe vera  | Ref. |
Plantae | Euphorbiaceae | Sapium haematospermum  | Ref. |
Plantae | Poaceae | Oryza sativa  | Ref. |
Plantae | Solanaceae | Solanum chacoense Bitt. | Ref. |
Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
- | - | Caffea sp. | Ref. |
|
|
zoom in
Organism | Aloe sabaea | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|