Name |
3-Octanone Octan-3-one |
Formula |
C8H16O |
Mw |
128.12011513 |
CAS RN |
106-68-3 |
C_ID |
C00034765
,
|
InChIKey |
RHLVCLIPMVJYKS-UHFFFAOYSA-N |
InChICode |
InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h3-7H2,1-2H3 |
SMILES |
CCCCCC(=O)CC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Cancer cells) | Ref. |
Fungi | Polyporaceae | Lentinus edodes | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Labiatae | Agastache rugosus | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Labiatae | Lavandula angustifolia | Ref. |
Plantae | Labiatae | Lavandula multifida | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Schizonepeta temuifolia | Ref. |
Plantae | Labiatae | Thymus broussonetti | Ref. |
Plantae | Labiatae | Thymus maroccanus | Ref. |
Plantae | Labiatae | Thymus praecos | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
- | - | Lavandin abrialis | Ref. |
- | - | Spongiporus leucomallellus (Murril) | Ref. |
|
|
zoom in
Organism | Thymus maroccanus | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|