| Name |
4-(beta-D-Glucopyranosyloxy) benzyl alcohol Gastrodin (-)-Gastrodin |
| Formula |
C13H18O7 |
| Mw |
286.10525293 |
| CAS RN |
62499-27-8 |
| C_ID |
C00029516
, 
|
| InChIKey |
PUQSUZTXKPLAPR-BNWABVEUNA-N |
| InChICode |
InChI=1S/C13H18O7/c14-5-7-1-3-8(4-2-7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-4,9-18H,5-6H2/t9-,10+,11+,12-,13-/m1/s1 |
| SMILES |
OCc1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cucurbitaceae | Citrullus colocynthis (L.)  | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Orchidaceae | Anoectochilus formosanus | Ref. |
| Plantae | Orchidaceae | Gastrodia elata  | Ref. |
| Plantae | Orchidaceae | Gymnadenia conopsea | Ref. |
|
|
zoom in
| Organism | Origanum vulgare | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|