Name |
Glycitein 7,4'-Dihydroxy-6-methoxyisoflavone |
Formula |
C16H12O5 |
Mw |
284.06847349 |
CAS RN |
40957-83-3 |
C_ID |
C00009392
, 
|
InChIKey |
DXYUAIFZCFRPTH-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O5/c1-20-15-6-11-14(7-13(15)18)21-8-12(16(11)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
SMILES |
COc1cc2c(=O)c(-c3ccc(O)cc3)coc2cc1O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Annona muricata  | Ref. |
Plantae | Apiaceae | Bupleurum scorzonerifolium  | Ref. |
Plantae | Asphodelaceae | Aloe vera  | Ref. |
Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
Plantae | Fabaceae | Centrosema haitiense | Ref. |
Plantae | Fabaceae | Centrosema pubescens | Ref. |
Plantae | Fabaceae | Cicer arietinum  | Ref. |
Plantae | Fabaceae | Dalbergia frutescens | Ref. |
Plantae | Fabaceae | Glycine max  | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
Plantae | Fabaceae | Maackia amurensis  | Ref. |
Plantae | Fabaceae | Medicago sativa  | Ref. |
Plantae | Fabaceae | Mildbraediodendron excelsum | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
Plantae | Fabaceae | Pisum sativum  | Ref. |
Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
Plantae | Fabaceae | Pterocarpus marsupium  | Ref. |
Plantae | Fabaceae | Pueraria lobata  | Ref. |
Plantae | Fabaceae | Pueraria thunbergiana  | Ref. |
Plantae | Fabaceae | Pueraria tuberosa  | Ref. |
Plantae | Fabaceae | Trifolium pratense  | Ref. |
Plantae | Fabaceae | Trifolium repens  | Ref. |
Plantae | Fabaceae | Vigna radiata  | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Psidium guajava  | Ref. |
- | - | Sarcolobus globosus | Ref. |
|
|
zoom in
Organism | Trifolium repens | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|