Name |
Allantoin |
Formula |
C4H6N4O3 |
Mw |
158.04399009 |
CAS RN |
97-59-6 |
C_ID |
C00007468
, 
|
InChIKey |
POJWUDADGALRAB-UHFFFAOYNA-N |
InChICode |
InChI=1S/C4H6N4O3/c5-3(10)6-1-2(9)8-4(11)7-1/h1H,(H3,5,6,10)(H2,7,8,9,11)/t1-/m1/s1 |
SMILES |
NC(=O)NC1NC(=O)NC1=O |
Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp |
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
Plantae | Acanthaceae | Rhinacanthus nasutus | Ref. |
Plantae | Alliaceae | Allium tuberosum Rottl.ex Spreng.  | Ref. |
Plantae | Araliaceae | Acanthopanax giraldii | Ref. |
Plantae | Aristolochiaceae | Aristolochia heterophylla Hemsl  | Ref. |
Plantae | Aristolochiaceae | Aristolochia pubescens | Ref. |
Plantae | Boraginaceae | Auxemma oncocalyx  | Ref. |
Plantae | Caryophyllaceae | Vaccaria segetalis  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Dioscoreaceae | Dioscorea bulbifera  | Ref. |
Plantae | Fabaceae | Glycine max  | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
Plantae | Fabaceae | Robinia pseudoacacia  | Ref. |
Plantae | Heliotropiaceae | Tournefortia sarmentosa | Ref. |
Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
Plantae | Solanaceae | Solanum tuberosum  | Ref. |
- | - | Caffea sp. | Ref. |
|
|
zoom in
Organism | Dioscorea bulbifera | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|