| Name |
Saccharopine |
| Formula |
C11H20N2O6 |
| Mw |
276.13213639 |
| CAS RN |
997-68-2 |
| C_ID |
C00007227
, 
|
| InChIKey |
ZDGJAHTZVHVLOT-YZYOREDDNA-N |
| InChICode |
InChI=1S/C11H20N2O6/c12-7(10(16)17)3-1-2-6-13-8(11(18)19)4-5-9(14)15/h7-8,13H,1-6,12H2,(H,14,15)(H,16,17)(H,18,19)/t7-,8-/m0/s1 |
| SMILES |
N[C@@H](CCCCN[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Polyporaceae | Lentinus edodes  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| - | - | Undifilum oxytropis | Ref. |
|
|
zoom in
| Organism | Nicotiana tabacum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|