| Name |
Kaempferol 3-(2G-glucosylrutinoside) Kaempferol 3-(6'''-rhamnosyl-2'''-glucosyl-glucoside) |
| Formula |
C33H40O20 |
| Mw |
756.21129372 |
| CAS RN |
55696-58-7 |
| C_ID |
C00005217
, 
|
| InChIKey |
VNLOLXSJMINBIS-JHXMEOJSNA-N |
| InChICode |
InChI=1S/C33H40O20/c1-10-19(38)23(42)26(45)31(48-10)47-9-17-21(40)25(44)30(53-32-27(46)24(43)20(39)16(8-34)50-32)33(51-17)52-29-22(41)18-14(37)6-13(36)7-15(18)49-28(29)11-2-4-12(35)5-3-11/h2-7,10,16-17,19-21,23-27,30-40,42-46H,8-9H2,1H3/t10-,16+,17+,19-,20+,21+,23-,24-,25-,26+,27+,30+,31+,32-,33-/m0/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3c(-c4ccc(O)cc4)oc4cc(O)cc(O)c4c3=O)C(O[C@@H]3OC(CO)[C@@H](O)C(O)[C@H]3O)C(O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Hostaceae | Hosta ventricosa | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Solanaceae | Solanum spp. | Ref. |
| Plantae | Theaceae | Camellia oleifera | Ref. |
|
|
zoom in
| Organism | Hosta ventricosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Henning,Phytochem.,19,(1980),2727
Budzianowski,Phytochem.,29,(1990),3643 |
|---|
|