Name |
Taraxerol Alnulin Skimmiol Tiliadin |
Formula |
C30H50O |
Mw |
426.38616622 |
CAS RN |
127-22-0 |
C_ID |
C00003758
, 
|
InChIKey |
GGGUGZHBAOMSFJ-YXYDKRSONA-N |
InChICode |
InChI=1S/C30H50O/c1-25(2)17-18-27(5)13-9-21-29(7)14-10-20-26(3,4)24(31)12-16-28(20,6)22(29)11-15-30(21,8)23(27)19-25/h9,20,22-24,31H,10-19H2,1-8H3/t20-,22+,23+,24-,27-,28-,29-,30+/m0/s1 |
SMILES |
CC1(C)CC[C@]2(C)CC=C3[C@]4(C)CC[C@H]5C(C)(C)[C@@H](O)CC[C@]5(C)[C@H]4CC[C@@]3(C)[C@@H]2C1 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Strobilanthes callosus  | Ref. |
Plantae | Anacardiaceae | Mangifera persiciformis | Ref. |
Plantae | Annonaceae | Annona reticulata  | Ref. |
Plantae | Araliaceae | Acanthopanax trifoliatus  | Ref. |
Plantae | Asteraceae | Ageratina pichinchensis var. bustamenta | Ref. |
Plantae | Asteraceae | Launaea nudicaulis  | Ref. |
Plantae | Asteraceae | Taraxacum officinale  | Ref. |
Plantae | Asteraceae | Xanthium canadense Mill. | Ref. |
Plantae | Betulaceae | Alnus glutinosa  | Ref. |
Plantae | Betulaceae | Alnus incana  | Ref. |
Plantae | Burseraceae | Canarium spp. | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum bracteatum | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum cordato-oblongum | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum thwaitesii | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum trapezifolium | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum walkeri | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula  | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis subglobosa | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis tangshen  | Ref. |
Plantae | Crassulaceae | Kalanchoe daigremontiana | Ref. |
Plantae | Crassulaceae | Kalanchoe spathulata | Ref. |
Plantae | Ebenaceae | Diospyros cordifolia  | Ref. |
Plantae | Ebenaceae | Diospyros ferrea | Ref. |
Plantae | Ebenaceae | Diospyros hirsuta | Ref. |
Plantae | Ebenaceae | Diospyros kaki  | Ref. |
Plantae | Ebenaceae | Diospyros lotus  | Ref. |
Plantae | Ebenaceae | Diospyros mollis  | Ref. |
Plantae | Ebenaceae | Diospyros morrisiana | Ref. |
Plantae | Ebenaceae | Diospyros nicaraguensis | Ref. |
Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
Plantae | Ebenaceae | Diospyros spp. | Ref. |
Plantae | Ericaceae | Enkianthus cernuus | Ref. |
Plantae | Ericaceae | Leucothoe grayana Max. | Ref. |
Plantae | Ericaceae | Pieris japonica D.Don.  | Ref. |
Plantae | Euphorbiaceae | Euphorbia hirta  | Ref. |
Plantae | Euphorbiaceae | Euphorbia indica  | Ref. |
Plantae | Euphorbiaceae | Euphorbia myrsinites | Ref. |
Plantae | Euphorbiaceae | Excoecaria agallocha L.  | Ref. |
Plantae | Euphorbiaceae | Macaranga triloba | Ref. |
Plantae | Euphorbiaceae | Manihot esculenta  | Ref. |
Plantae | Fabaceae | Dalbergia sericea | Ref. |
Plantae | Fagaceae | Lithocarpus spp. | Ref. |
Plantae | Jubulaceae | Frullania fugax | Ref. |
Plantae | Lauraceae | Litsea dealbata | Ref. |
Plantae | Lauraceae | Neolitsea konishii | Ref. |
Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
Plantae | Malvaceae | Tilia cordata Mill.  | Ref. |
Plantae | Myricaceae | Myrica rubra  | Ref. |
Plantae | Myrsinaceae | Embelia schimperi  | Ref. |
Plantae | Ranunculaceae | Nigella sativa  | Ref. |
Plantae | Rhamnaceae | Sageretia theezans  | Ref. |
Plantae | Rhamnaceae | Ventilago leiocarpa | Ref. |
Plantae | Rubiaceae | Hedyotis acutangula | Ref. |
Plantae | Rutaceae | Skimmia japonica | Ref. |
Plantae | Rutaceae | Skimmia wallachii | Ref. |
Plantae | Rutaceae | Vepris punctata | Ref. |
Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
Plantae | Styracaceae | Styrax japonica | Ref. |
|
|
zoom in
Organism | Sageretia theezans | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Xu, et al., CCMM, 19, (1994), 675.
Si, et al., CCMM, 20, (1995), 295.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Lin, et al., JNP, 64, (2001), 674.
MATSUDA, et al., Chem Pharm Bull, 50, (2002), 208.
Min, et al., JNP, 67, (2004), 1980.
Chaturvedula, et al., Planta Med, 69, (2003), 271.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|