| Name |
trans,trans-Farnesol Farnesol |
| Formula |
C15H26O |
| Mw |
222.19836545 |
| CAS RN |
4602-84-0 |
| C_ID |
C00003132
, 
|
| InChIKey |
CRDAMVZIKSXKFV-YFVJMOTDSA-N |
| InChICode |
InChI=1S/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3/b14-9+,15-11+ |
| SMILES |
CC(C)=CCC/C(C)=C/CC/C(C)=C/CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Chamomilla rectita | Ref. |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
| Plantae | Malvaceae | Abelmoschus moschatus  | Ref. |
| Plantae | Malvaceae | Hibiscus abelmoschus  | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Santalaceae | Santalum spicatum | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Zingiberaceae | Curcuma zedoaria  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Jasminum grandiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|