Name |
Fenchone (+)-Fenchone |
Formula |
C10H16O |
Mw |
152.12011513 |
CAS RN |
1195-79-5 |
C_ID |
C00003045
, 
|
InChIKey |
LHXDLQBQYFFVNW-NAJNNQRLNA-N |
InChICode |
InChI=1S/C10H16O/c1-9(2)7-4-5-10(3,6-7)8(9)11/h7H,4-6H2,1-3H3/t7-,10+/m1/s1 |
SMILES |
CC1(C)C(=O)[C@@]2(C)CC[C@@H]1C2 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
Plantae | Acanthaceae | Strobilanthes ixiocephala | Ref. |
Plantae | Apiaceae | Apium graveolens  | Ref. |
Plantae | Apiaceae | Falcaria vulgaris | Ref. |
Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
Plantae | Asteraceae | Artemisia annua  | Ref. |
Plantae | Asteraceae | Blumea lacera  | Ref. |
Plantae | Asteraceae | Tarchonanthus camphoratus  | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
Plantae | Fagaceae | Quercus coccifera  | Ref. |
Plantae | Labiatae | Lavandula stoechas  | Ref. |
Plantae | Labiatae | Ocimum basilicum  | Ref. |
Plantae | Labiatae | Plectranthus marrubioides | Ref. |
Plantae | Labiatae | Prunella vulgaris  | Ref. |
Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
Plantae | Labiatae | Tetradenia riparia  | Ref. |
Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
Plantae | Pinaceae | Pinus halepensis  | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
Plantae | Verbenaceae | Lippia ukambensis | Ref. |
- | - | Alphinia galanga | Ref. |
|
|
zoom in
Organism | Strobilanthes ixiocephala | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|