Name |
Dillapiol Dillapiole Dill apiole |
Formula |
C12H14O4 |
Mw |
222.08920894 |
CAS RN |
484-31-1 |
C_ID |
C00002737
, 
|
InChIKey |
LIKYNOPXHGPMIH-UHFFFAOYSA-N |
InChICode |
InChI=1S/C12H14O4/c1-4-5-8-6-9-11(16-7-15-9)12(14-3)10(8)13-2/h4,6H,1,5,7H2,2-3H3 |
SMILES |
C=CCc1cc2c(c(OC)c1OC)OCO2 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Annonaceae | Xylopia sericea  | Ref. |
Plantae | Apiaceae | Anethum graveolens  | Ref. |
Plantae | Apiaceae | Anethum sowa  | Ref. |
Plantae | Apiaceae | Apium graveolens  | Ref. |
Plantae | Apiaceae | Bunium persicum | Ref. |
Plantae | Apiaceae | Crithmum maritimum  | Ref. |
Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
Plantae | Apiaceae | Ligusticum scoticum  | Ref. |
Plantae | Asteraceae | Erigeron spp. | Ref. |
Plantae | Caryophyllaceae | Stellaria pallida | Ref. |
Plantae | Fabaceae | Tipuana tipu | Ref. |
Plantae | Monimiaceae | Laurelia serrata | Ref. |
Plantae | Piperaceae | Piper aduncum  | Ref. |
Plantae | Piperaceae | Piper novae-hollandiae | Ref. |
Plantae | Piperaceae | Piper spp. | Ref. |
- | - | Endicheria aff. | Ref. |
|
|
zoom in
Organism | Stellaria pallida | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|