Name |
Hinokiol (+)-Hinokiol |
Formula |
C20H30O2 |
Mw |
302.2245802 |
CAS RN |
564-73-8 |
C_ID |
C00002609
, 
|
InChIKey |
FVYXIJYOAGAUQK-UHFFFAOYSA-N |
InChICode |
InChI=1S/C18H18O2/c1-3-5-13-7-9-18(20)16(11-13)14-8-10-17(19)15(12-14)6-4-2/h3-4,7-12,19-20H,1-2,5-6H2 |
SMILES |
C=CCc1ccc(O)c(-c2ccc(O)c(CC=C)c2)c1 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
Plantae | Cephalotaxaceae | Cephalotaxus lanceolata | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Illiciaceae | Illicium fargesii | Ref. |
Plantae | Labiatae | Isodon flavidus | Ref. |
Plantae | Magnoliaceae | Magnolia obovata  | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
Plantae | Taxaceae | Taxus cuspidata  | Ref. |
Plantae | Taxaceae | Taxus mairei  | Ref. |
Plantae | Taxaceae | Torreya nucifera var.radicans  | Ref. |
Plantae | Taxodiaceae | Cryptomeria japonica | Ref. |
- | - | Tetraclinus articulata | Ref. |
|
|
zoom in
Organism | Cephalotaxus lanceolata | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|