| Name |
Novobiocin Albamix Albamycin Antibiotic PA-93 Cardelmycin Cathocin Cathomycin Crystallinic acid Inamycin Novo-R PA 93 Robiocina Sirbiocina Spheromycin Stilbiocina Streptonivicin U 6391 |
| Formula |
C31H36N2O11 |
| Mw |
612.23191001 |
| CAS RN |
303-81-1 |
| C_ID |
C00002487
, 
|
| InChIKey |
YJQPYGGHQPGBLI-HOIYPVHBNA-N |
| InChICode |
InChI=1S/C31H36N2O11/c1-14(2)7-8-16-13-17(9-11-19(16)34)27(37)33-21-22(35)18-10-12-20(15(3)24(18)42-28(21)38)41-29-23(36)25(43-30(32)39)26(40-6)31(4,5)44-29/h7,9-13,23,25-26,29,34-36H,8H2,1-6H3,(H2,32,39)(H,33,37)/t23-,25+,26+,29+/m0/s1 |
| SMILES |
CO[C@@H]1C(OC(N)=O)[C@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)c4ccc(O)c(CC=C(C)C)c4)c(=O)oc3c2C)OC1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Streptomycetaceae | Streptomyces niveus | Ref. |
| Bacteria | Streptomycetaceae | Streptomyces spheroides | Ref. |
| - | - | Ray-fungus Streppyomyes spheroids | Ref. |
|
|
zoom in
| Organism | Ray-fungus Streppyomyes spheroids | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|