| Name |
Angelicin |
| Formula |
C11H6O3 |
| Mw |
186.03169406 |
| CAS RN |
523-50-2 |
| C_ID |
C00002450
, 
|
| InChIKey |
XDROKJSWHURZGO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C11H6O3/c12-10-4-2-7-1-3-9-8(5-6-13-9)11(7)14-10/h1-6H |
| SMILES |
O=c1ccc2ccc3occc3c2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica archangelica  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Heracleum lehmannianum | Ref. |
| Plantae | Apiaceae | Heracleum spp. | Ref. |
| Plantae | Apiaceae | Ligusticum multivittatum | Ref. |
| Plantae | Apiaceae | Selinum vaginatum  | Ref. |
| Plantae | Fabaceae | Cullen drupaceum | Ref. |
| Plantae | Fabaceae | Hoita macrostachya | Ref. |
| Plantae | Fabaceae | Otholobium bolusii | Ref. |
| Plantae | Fabaceae | Otholobium foliosum | Ref. |
| Plantae | Fabaceae | Otholobium hirtum | Ref. |
| Plantae | Fabaceae | Otholobium obliquum | Ref. |
| Plantae | Fabaceae | Otholobium parviflorum | Ref. |
| Plantae | Fabaceae | Otholobium rotundifolium | Ref. |
| Plantae | Fabaceae | Otholobium sericeum | Ref. |
| Plantae | Fabaceae | Otholobium stachyerum | Ref. |
| Plantae | Fabaceae | Otholobium zeyheri | Ref. |
| Plantae | Fabaceae | Psoralea affinis | Ref. |
| Plantae | Fabaceae | Psoralea arborea | Ref. |
| Plantae | Fabaceae | Psoralea cinerea | Ref. |
| Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
| Plantae | Fabaceae | Psoralea effusa | Ref. |
| Plantae | Fabaceae | Psoralea exile | Ref. |
| Plantae | Fabaceae | Psoralea fascicularis | Ref. |
| Plantae | Fabaceae | Psoralea glabra | Ref. |
| Plantae | Fabaceae | Psoralea lachnostachys | Ref. |
| Plantae | Fabaceae | Psoralea leucantha | Ref. |
| Plantae | Fabaceae | Psoralea martinii | Ref. |
| Plantae | Fabaceae | Psoralea oreopolum | Ref. |
| Plantae | Fabaceae | Psoralea papillosa | Ref. |
| Plantae | Fabaceae | Psoralea plumosa | Ref. |
| Plantae | Fabaceae | Psoralea pullata | Ref. |
| Plantae | Fabaceae | Psoralea pustulata | Ref. |
| Plantae | Fabaceae | Psoralea ramulosa | Ref. |
| Plantae | Fabaceae | Psoralea speciosa | Ref. |
| Plantae | Fagaceae | Castanopsis indica  | Ref. |
| Plantae | Moraceae | Ficus nitida | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Haplophyllum patavinum | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Valerianaceae | Nardostachys jatamsi | Ref. |
|
|
zoom in
| Organism | Aegle marmelos | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|