| Name |
(+-)-alpha-Hydrastine (-)-alpha-Hydrastine alpha-Hydrastine |
| Formula |
C21H21NO6 |
| Mw |
383.13688741 |
| CAS RN |
4370-85-8 |
| C_ID |
C00001867
, 
|
| InChIKey |
JZUTXVTYJDCMDU-PVIFGLDDNA-N |
| InChICode |
InChI=1S/C21H21NO6/c1-22-7-6-11-8-15-16(27-10-26-15)9-13(11)18(22)19-12-4-5-14(24-2)20(25-3)17(12)21(23)28-19/h4-5,8-9,18-19H,6-7,10H2,1-3H3/t18-,19-/m1/s1 |
| SMILES |
COc1ccc2c(c1OC)C(=O)O[C@H]2[C@H]1c2cc3c(cc2CCN1C)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis longipes | Ref. |
| Plantae | Fumariaceae | Corydalis solida  | Ref. |
| Plantae | Fumariaceae | Fumaria indica  | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora  | Ref. |
| Plantae | Ranunculaceae/Hydrastidaceae | Hydrastis canadensis  | Ref. |
|
|
zoom in
| Organism | Fumaria indica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|