| Name |
Vincamine |
| Formula |
C21H26N2O3 |
| Mw |
354.19434271 |
| CAS RN |
1617-90-9 |
| C_ID |
C00001782
, 
|
| InChIKey |
RXPRRQLKFXBCSJ-YGPNDOBFNA-N |
| InChICode |
InChI=1S/C21H26N2O3/c1-3-20-10-6-11-22-12-9-15-14-7-4-5-8-16(14)23(17(15)18(20)22)21(25,13-20)19(24)26-2/h4-5,7-8,18,25H,3,6,9-13H2,1-2H3/t18-,20+,21+/m1/s1 |
| SMILES |
CC[C@]12CCCN3CCc4c(n(c5ccccc45)[C@@](O)(C(=O)OC)C1)[C@@H]32 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp L-Pro Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Vinca erecta Rgl.et Schmalh. | Ref. |
| Plantae | Apocynaceae | Vinca herbacea Waldst.et Kit. | Ref. |
| Plantae | Apocynaceae | Vinca major | Ref. |
| Plantae | Apocynaceae | Vinca minor | Ref. |
| Plantae | Apocynaceae | Vinca sp. | Ref. |
|
|
zoom in
| Organism | Catharanthus roseus |
|---|
| Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
