Name |
Hordenine Anhalin Anhaline Cactine |
Formula |
C10H15NO |
Mw |
165.11536411 |
CAS RN |
539-15-1 |
C_ID |
C00001417
, 
|
InChIKey |
KUBCEEMXQZUPDQ-UHFFFAOYSA-N |
InChICode |
InChI=1S/C10H15NO/c1-11(2)8-7-9-3-5-10(12)6-4-9/h3-6,12H,7-8H2,1-2H3 |
SMILES |
CN(C)CCc1ccc(O)cc1 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Amaryllidaceae | Galanthus elewesii | Ref. |
Plantae | Amaryllidaceae | Galanthus plicatus spp.byzantinus | Ref. |
Plantae | Annonaceae | Anomianthus dulcis  | Ref. |
Plantae | Apocynaceae | Stapelia hirsuta | Ref. |
Plantae | Cactaceae | Ariocarpus kotschoubeyanus | Ref. |
Plantae | Cactaceae | Ariocarpus scapharostrus | Ref. |
Plantae | Cactaceae | Espostoa huanucensis | Ref. |
Plantae | Cactaceae | Pereskia aculeata  | Ref. |
Plantae | Cactaceae | Turbinicarpus alonsoi | Ref. |
Plantae | Ephedraceae | Ephedra aphylla | Ref. |
Plantae | Fabaceae | Acacia baileyana | Ref. |
Plantae | Fabaceae | Acacia harpophylla | Ref. |
Plantae | Fabaceae | Acacia holosericea  | Ref. |
Plantae | Fabaceae | Acacia rigidula Benth. | Ref. |
Plantae | Fabaceae | Acacia spirorbis | Ref. |
Plantae | Fabaceae | Dendrolobium triangulare | Ref. |
Plantae | Fabaceae | Desmodium elegans | Ref. |
Plantae | Fabaceae | Desmodium multiflorum  | Ref. |
Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
Plantae | Poaceae | Hordeum vulgare  | Ref. |
Plantae | Poaceae | Panicum miliaceum  | Ref. |
Plantae | Poaceae | Phalaris arundinacea | Ref. |
Plantae | Rutaceae | Citrus aurantium  | Ref. |
Plantae | Rutaceae | Citrus bergamia  | Ref. |
Plantae | Rutaceae | Citrus limon  | Ref. |
Plantae | Rutaceae | Citrus medica  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
- | - | Lobivia bachenbergii | Ref. |
- | - | Lobivia binghamiana | Ref. |
- | - | Lobivia pentlandii | Ref. |
- | - | Mastocarpus stellatus  | Ref. |
- | - | Pseudolobivia kermesina | Ref. |
|
|
zoom in
Organism | Corydalis yanhusuo | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|