Name |
Arachidic acid Eicosanoic acid Arachic acid |
Formula |
C20H40O2 |
Mw |
312.30283052 |
CAS RN |
506-30-9 |
C_ID |
C00001209
, 
|
InChIKey |
VKOBVWXKNCXXDE-UHFFFAOYSA-N |
InChICode |
InChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22) |
SMILES |
CCCCCCCCCCCCCCCCCCCC(=O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Annonaceae | Annona squamosa  | Ref. |
Plantae | Aquifoliaceae | Ilex integra | Ref. |
Plantae | Asteraceae | Silybum marianum  | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum calaba | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
Plantae | Cruciferae | Isatis tinctoria  | Ref. |
Plantae | Fabaceae | Arachis hypogaea  | Ref. |
Plantae | Fabaceae | Bauhinia tomentosa  | Ref. |
Plantae | Fabaceae | Cassia absu | Ref. |
Plantae | Fabaceae | Clitoria ternata | Ref. |
Plantae | Fabaceae | Glycine max  | Ref. |
Plantae | Fabaceae | Mucuna puriens | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
Plantae | Labiatae | Salvia officinalis  | Ref. |
Plantae | Labiatae | Thymus capitatus  | Ref. |
Plantae | Lythraceae | Lagerstroemia thomsonil | Ref. |
Plantae | Lythraceae | Punica granatum  | Ref. |
Plantae | Malvaceae | Tilia cordata Mill.  | Ref. |
Plantae | Myrtaceae | Myrtus communis  | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
Plantae | Orobanchaceae | Pedicularis muscicola | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Poaceae | Triticum aestivum  | Ref. |
Plantae | Rosaceae | Prunus avium  | Ref. |
Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
Plantae | Solanaceae | Solanum tuberosum  | Ref. |
Plantae | Zingiberaceae | Curcuma longa  | Ref. |
- | - | FOOD SAKE | Ref. |
|
|
zoom in
Organism | Mucuna puriens | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|