Name |
Fumaric acid |
Formula |
C4H4O4 |
Mw |
116.01095862 |
CAS RN |
110-17-8 |
C_ID |
C00001183
, 
|
InChIKey |
VZCYOOQTPOCHFL-OWOJBTEDSA-N |
InChICode |
InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+ |
SMILES |
O=C(O)/C=C/C(=O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
Bacteria | Pseudomonadaceae | Pseudomonas putida | Ref. |
Fungi | Cladoniaceae | Cladonia fallax | Ref. |
Fungi | Cladoniaceae | Cladonia rangiferina  | Ref. |
Fungi | Ganodermataceae | Ganoderma japonicum | Ref. |
Fungi | Mucoraceae | Rhizopus nigricans | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Apiaceae | Apium graveolens  | Ref. |
Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
Plantae | Araliaceae | Panax ginseng  | Ref. |
Plantae | Asteraceae | Ageratina conyzoides | Ref. |
Plantae | Asteraceae | Cirsium wallichii  | Ref. |
Plantae | Asteraceae | Helianthus annuus  | Ref. |
Plantae | Asteraceae | Senecio nemorensis | Ref. |
Plantae | Boraginaceae | Lithospermum arvense  | Ref. |
Plantae | Caricaceae | Carica papaya  | Ref. |
Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea  | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
Plantae | Daphniphyllaceae | Daphniphyllum calycinum  | Ref. |
Plantae | Euphorbiaceae | Euphorbia antiquorum  | Ref. |
Plantae | Fabaceae | Astragalus alopecurus | Ref. |
Plantae | Fabaceae | Cicer arietinum  | Ref. |
Plantae | Fabaceae | Medicago sativa  | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
Plantae | Fabaceae | Pisum sativum  | Ref. |
Plantae | Fabaceae | Sophora alopecuroides | Ref. |
Plantae | Fabaceae | Vicia faba  | Ref. |
Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
Plantae | Lythraceae | Punica granatum  | Ref. |
Plantae | Malvaceae | Abutilon indicum  | Ref. |
Plantae | Moraceae | Ficus carica  | Ref. |
Plantae | Papaveraceae | Glaucium flavum  | Ref. |
Plantae | Plantaginaceae | Plantago major  | Ref. |
Plantae | Poaceae | Oryza sativa  | Ref. |
Plantae | Poaceae | Saccharum sinensis | Ref. |
Plantae | Poaceae | Triticum aestivum  | Ref. |
Plantae | Polypodiaceae | Pyrrosia shearei | Ref. |
Plantae | Rosaceae | Malus domestica  | Ref. |
Plantae | Rosaceae | Prunus avium  | Ref. |
Plantae | Rubiaceae | Morinda officinalis  | Ref. |
Plantae | Sapotaceae | Sebertia acuminata | Ref. |
Plantae | Solanaceae | Capsicum annuum  | Ref. |
Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
Plantae | Solanaceae | Solanum tuberosum  | Ref. |
Plantae | Taxaceae | Torreya yunnanensis | Ref. |
Plantae | Urticaceae | Urtica dioica  | Ref. |
Plantae | Zingiberaceae | Curcuma domestica  | Ref. |
- | - | FOOD SAKE | Ref. |
|
|
zoom in
Organism | Morinda officinalis | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|