| Name |
Melibiose |
| Formula |
C12H22O11 |
| Mw |
342.11621155 |
| CAS RN |
585-99-9 |
| C_ID |
C00001142
, 
|
| InChIKey |
DLRVVLDZNNYCBX-QVVOTYHANA-N |
| InChICode |
InChI=1S/C12H22O11/c13-1-3-5(14)8(17)10(19)12(23-3)21-2-4-6(15)7(16)9(18)11(20)22-4/h3-20H,1-2H2/t3-,4+,5-,6+,7+,8+,9+,10-,11-,12+/m1/s1 |
| SMILES |
OCC1O[C@H](OCC2O[C@@H](O)C(O)[C@@H](O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Rosaceae | Pyrus malus  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Pyrus malus | | Reference | Aldrich Library of 13C and 1H FT NMR Spectra,1,(1992),309C |
|---|
|