Name |
Myricetin |
Formula |
C15H10O8 |
Mw |
318.0375673 |
CAS RN |
529-44-2 |
C_ID |
C00001071
, 
|
InChIKey |
IKMDFBPHZNJCSN-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H10O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,16-20,22H |
SMILES |
O=c1c(O)c(-c2cc(O)c(O)c(O)c2)oc2cc(O)cc(O)c12 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Strobilanthes crispus | Ref. |
Plantae | Alliaceae | Allium obliquum | Ref. |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Anacardiaceae | Buchanania lanzan | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Anacardiaceae | Rhus parviflora | Ref. |
Plantae | Anacardiaceae | Rhus wallichi | Ref. |
Plantae | Anacardiaceae | Semecarpus vitiensis | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asteraceae | Haplopappus canescens | Ref. |
Plantae | Betulaceae | Betula platyphylla var. japonica | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Crassulaceae | Sedum takesimense Nakai | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Cucurbitaceae | Citrullus colocynthis | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Cunoniaceae | Davidsonia pruriens | Ref. |
Plantae | Cupressaceae | Thuja orientalis | Ref. |
Plantae | Dioscoreaceae | Dioscorea bulbifera | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Ericaceae | Rhododendron brachycarpum ssp.brachycarpum | Ref. |
Plantae | Ericaceae | Rhododendron calophytum | Ref. |
Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
Plantae | Ericaceae | Rhododendron Cunningham's white | Ref. |
Plantae | Ericaceae | Rhododendron degronianum ssp. Heptamerum var. hondoense | Ref. |
Plantae | Ericaceae | Rhododendron fortunei | Ref. |
Plantae | Ericaceae | Rhododendron kaempferi | Ref. |
Plantae | Ericaceae | Rhododendron micranthum | Ref. |
Plantae | Ericaceae | Rhododendron mucronatum | Ref. |
Plantae | Ericaceae | Rhododendron ponticum | Ref. |
Plantae | Ericaceae | Rhododendron praevernum | Ref. |
Plantae | Ericaceae | Rhododendron smirnowii | Ref. |
Plantae | Ericaceae | Rhododendron ungernii | Ref. |
Plantae | Euphorbiaceae | Euphorbia palustris | Ref. |
Plantae | Euphorbiaceae | Euphorbia stepposa | Ref. |
Plantae | Fabaceae | Acacia aroma | Ref. |
Plantae | Fabaceae | Acacia cyanophylla | Ref. |
Plantae | Fabaceae | Acacia dealbata | Ref. |
Plantae | Fabaceae | Astragalus complanatus | Ref. |
Plantae | Fabaceae | Caragana frutex | Ref. |
Plantae | Fabaceae | Caragana jubata | Ref. |
Plantae | Fabaceae | Ceratonia siliqua | Ref. |
Plantae | Fabaceae | Hypocalyptus sophoroides | Ref. |
Plantae | Fabaceae | Intsia bijuga | Ref. |
Plantae | Fabaceae | Intsia palembanica | Ref. |
Plantae | Fabaceae | Lathyrus aphaca | Ref. |
Plantae | Fabaceae | Lathyrus spp. | Ref. |
Plantae | Fabaceae | Lotus maritimus | Ref. |
Plantae | Fabaceae | Medicago arabica | Ref. |
Plantae | Fabaceae | Medicago blancheana | Ref. |
Plantae | Fabaceae | Medicago cancellata | Ref. |
Plantae | Fabaceae | Medicago cretacea | Ref. |
Plantae | Fabaceae | Medicago doliata | Ref. |
Plantae | Fabaceae | Medicago falcata | Ref. |
Plantae | Fabaceae | Medicago glomerata | Ref. |
Plantae | Fabaceae | Medicago hybrida | Ref. |
Plantae | Fabaceae | Medicago intertexta | Ref. |
Plantae | Fabaceae | Medicago laciniata | Ref. |
Plantae | Fabaceae | Medicago lupulina | Ref. |
Plantae | Fabaceae | Medicago monantha | Ref. |
Plantae | Fabaceae | Medicago monspeliaca | Ref. |
Plantae | Fabaceae | Medicago murex | Ref. |
Plantae | Fabaceae | Medicago orbicularis | Ref. |
Plantae | Fabaceae | Medicago polyceratia | Ref. |
Plantae | Fabaceae | Medicago polymorpha | Ref. |
Plantae | Fabaceae | Medicago radiata | Ref. |
Plantae | Fabaceae | Medicago rotata | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Medicago scutellata | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Melilotus italica | Ref. |
Plantae | Fabaceae | Melilotus messanensis | Ref. |
Plantae | Fabaceae | Melilotus officinalis | Ref. |
Plantae | Fabaceae | Melilotus sulcatus | Ref. |
Plantae | Fabaceae | Melilotus wolgicus | Ref. |
Plantae | Fabaceae | Millettia racemosa | Ref. |
Plantae | Fabaceae | Peltophorum africanum | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Prosopis reptans | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Trifolium repens | Ref. |
Plantae | Fabaceae | Trigonella balansae | Ref. |
Plantae | Fabaceae | Trigonella calliceras | Ref. |
Plantae | Fabaceae | Trigonella cretica | Ref. |
Plantae | Fabaceae | Trigonella geminiflora | Ref. |
Plantae | Fabaceae | Vicia bithynica | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fabaceae | Vicia johannis | Ref. |
Plantae | Fumariaceae | Fumaria capreolata | Ref. |
Plantae | Fumariaceae | Fumaria officinalis | Ref. |
Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
Plantae | Fumariaceae | Fumaria vaillantii | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hydrocharitaceae | Halophila johnsonii | Ref. |
Plantae | Hypericaceae | Hypericum hirsutum | Ref. |
Plantae | Hypericaceae | Hypericum scabrum | Ref. |
Plantae | Iridaceae | Crocus sativus | Ref. |
Plantae | Labiatae | Salvia hispanica | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Lauraceae | Machilus bombycina | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Abelmoschus manihot | Ref. |
Plantae | Malvaceae | Hibiscus sabdariffa L. | Ref. |
Plantae | Meliaceae | Soymida febrifuga | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrina | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Musaceae | Musa acuminata | Ref. |
Plantae | Myricaceae | Myrica cerifera | Ref. |
Plantae | Myricaceae | Myrica nagi | Ref. |
Plantae | Myricaceae | Myrica rubra | Ref. |
Plantae | Myrsinaceae | Ardisia colorata | Ref. |
Plantae | Myrtaceae | Eucalyptus globulus | Ref. |
Plantae | Myrtaceae | Eugenia jambolana | Ref. |
Plantae | Myrtaceae | Kunzea ericoides | Ref. |
Plantae | Myrtaceae | Pimenta dioica | Ref. |
Plantae | Myrtaceae | Plinia pinnata | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Myrtaceae | Syzygium aromaticum | Ref. |
Plantae | Myrtaceae | Syzygium cumini | Ref. |
Plantae | Myrtaceae | Syzygium samarangense | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus antarctica | Ref. |
Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
Plantae | Nymphaeaceae | Nymphaea lotus | Ref. |
Plantae | Nymphaeaceae | Nymphaea odorata | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Phyllanthaceae | Bridelia ferruginea | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Pinaceae | Pseudolarix amabilis | Ref. |
Plantae | Polygonaceae | Eskemukerjea megacarpum HARA | Ref. |
Plantae | Polygonaceae | Polygonum amphibium | Ref. |
Plantae | Polygonaceae | Polygonum aviculare | Ref. |
Plantae | Polygonaceae | Polygonum bistorta | Ref. |
Plantae | Polygonaceae | Polygonum convolvulus | Ref. |
Plantae | Polygonaceae | Polygonum equiseiforme | Ref. |
Plantae | Polygonaceae | Polygonum hydropiper | Ref. |
Plantae | Polygonaceae | Polygonum lapathifolium | Ref. |
Plantae | Polygonaceae | Polygonum mite | Ref. |
Plantae | Polygonaceae | Polygonum persicaria | Ref. |
Plantae | Polygonaceae | Polygonum viscosum | Ref. |
Plantae | Polygonaceae | Rumex thyrsiflorus | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Rhamnaceae | Hovenia dulcis | Ref. |
Plantae | Rosaceae | Rosa damascene | Ref. |
Plantae | Sapindaceae | Xanthoceras sorbifolia | Ref. |
Plantae | Sapotaceae | Diploknema butyracea | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Taxaceae | Taxus buccata | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Taxaceae | Taxus cuspidata | Ref. |
Plantae | Vitaceae | Ampelopsis grossedentata | Ref. |
- | - | Morella rubra | Ref. |
- | - | Oxycoccus quadripetalis | Ref. |
|
|
zoom in
Organism | Thuja orientalis | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Yuan, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 23, (1998), 359.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Huang, et al., Zhiwu Xuebao, 23, (1981), 222.
MATSUDA, et al., Chem Pharm Bull, 50, (2002), 208.
SUMINO, et al., Chem Pharm Bull, 50, (2002), 1484.
Kuo, et al., Planta Med, 70, (2004), 1237.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chang, et al., Dictionary of Chemistry, Science Press, Beijing, (2008) |
---|
|