| Name |
Citronellol |
| Formula |
C10H20O |
| Mw |
156.15141526 |
| CAS RN |
106-22-9 |
| C_ID |
C00000844
, 
|
| InChIKey |
QMVPMAAFGQKVCJ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C10H20O/c1-9(2)5-4-6-10(3)7-8-11/h5,10-11H,4,6-8H2,1-3H3/t10-/m1/s1 |
| SMILES |
CC(C)=CCCC(C)CCO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Amaryllidaceae | Narcissus tazetta var.chinensis  | Ref. |
| Plantae | Apiaceae | Daucus carota var.sativa  | Ref. |
| Plantae | Cupressaceae | Juniperus rigida | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Geraniaceae | Pelargonium capitatum  | Ref. |
| Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
| Plantae | Geraniaceae | Pelargonium hortorum | Ref. |
| Plantae | Geraniaceae | Pelargonium tomentosum  | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Dracocephalum moldavica  | Ref. |
| Plantae | Labiatae | Melissa officinalis  | Ref. |
| Plantae | Labiatae | Thymus pubescens | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Meliaceae | Melia azadirach | Ref. |
| Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Rosa rugosa  | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus aurantium var.amara  | Ref. |
| Plantae | Rutaceae | Citrus junos  | Ref. |
| Plantae | Rutaceae | Citrus limettioides | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Toddalia asiatica  | Ref. |
| Plantae | Salicaceae | Salix aegyptiaca | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera Meerb.  | Ref. |
| Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Juniperus rigida | | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Xie, et al., Chapter 28, JIU LI XIANG, in Modern Stydies of Chinese Herbal Medicine, edited. By Institute of Materia Medica, Chinese Academy of Medical Sciences, Vol.2, 333-61, Union Press of Beijing Medical University and Peking Union Medical College, Geijing, (1996). |
|---|
|