Name |
(E)-p-Coumaric acid trans-4-Hydroxycinnamic acid trans-p-Coumaric acid trans-p-Hydroxycinnamic acid |
Formula |
C9H8O3 |
Mw |
164.04734412 |
CAS RN |
501-98-4 |
C_ID |
C00000580
,
|
InChIKey |
NGSWKAQJJWESNS-ZZXKWVIFSA-N |
InChICode |
InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+ |
SMILES |
O=C(O)/C=C/c1ccc(O)cc1 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Araliaceae | Aralia elata | Ref. |
Plantae | Asteraceae | Helianthus tuberosus | Ref. |
Plantae | Asteraceae | Taraxacum formosanum | Ref. |
Plantae | Brassicaceae | Wasabia japonica | Ref. |
Plantae | Chenopodiaceae | Spinacia oleracea | Ref. |
Plantae | Crassulaceae | Rhodiola sachalinensis | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Phaseolus aureus | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Scutellaria albida subsp.albida | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Abutilon indicum | Ref. |
Plantae | Meliaceae | Xylocarpus granatum | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Piperaceae | Peperomia duclouxii C.DC. | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Salicaceae | Salix purpurea | Ref. |
Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
Plantae | Scrophulariaceae | Scrophularia frutescens | Ref. |
Plantae | Scrophulariaceae | Scrophularia huergeriana | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
- | - | Caffea sp. | Ref. |
- | - | FOOD SAKE | Ref. |
|
|
zoom in
Organism | Scrophularia huergeriana | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|