Name |
Carvacrol |
Formula |
C10H14O |
Mw |
150.10446507 |
CAS RN |
499-75-2 |
C_ID |
C00000156
, 
|
InChIKey |
RECUKUPTGUEGMW-UHFFFAOYSA-N |
InChICode |
InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3 |
SMILES |
Cc1ccc(C(C)C)cc1O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Cyprinidae | Orthodon hadai | Ref. |
Plantae | -- | Lonicera japonica  | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Annonaceae | Xylopia sericea  | Ref. |
Plantae | Apiaceae | Angelica sinensis  | Ref. |
Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
Plantae | Asteraceae | Ageratina jocotepecana | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia annua  | Ref. |
Plantae | Asteraceae | Baccharis dracunculifolia  | Ref. |
Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
Plantae | Asteraceae | Matricaria recutita  | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
Plantae | Burseraceae | Canarium album  | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Gentianaceae | Gentiana lutea  | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Labiatae | Mosla chinensis | Ref. |
Plantae | Labiatae | Ocimum basilicum  | Ref. |
Plantae | Labiatae | Origanum dubium | Ref. |
Plantae | Labiatae | Origanum vulgare  | Ref. |
Plantae | Labiatae | Perilla frutescens  | Ref. |
Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
Plantae | Labiatae | Salvia officinalis  | Ref. |
Plantae | Labiatae | Satureja thymbra  | Ref. |
Plantae | Labiatae | Thymus algeriensis | Ref. |
Plantae | Labiatae | Thymus broussonetii | Ref. |
Plantae | Labiatae | Thymus broussonetti | Ref. |
Plantae | Labiatae | Thymus capitatus  | Ref. |
Plantae | Labiatae | Thymus caramanicus | Ref. |
Plantae | Labiatae | Thymus daenensis | Ref. |
Plantae | Labiatae | Thymus magnus | Ref. |
Plantae | Labiatae | Thymus maroccanus | Ref. |
Plantae | Labiatae | Thymus piperella  | Ref. |
Plantae | Labiatae | Thymus praecos | Ref. |
Plantae | Labiatae | Thymus pubescens | Ref. |
Plantae | Labiatae | Thymus quinquecostatus | Ref. |
Plantae | Labiatae | Thymus vulgaris  | Ref. |
Plantae | Lamiaceae | Calamintha nepeta subsp. glandulosa  | Ref. |
Plantae | Lamiaceae | Coleus aromaticus  | Ref. |
Plantae | Lamiaceae | Coridothymus capitatus  | Ref. |
Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
Plantae | Lauraceae | Ocotea corymbosa | Ref. |
Plantae | Moraceae | Morus alba  | Ref. |
Plantae | Myrtaceae | Psidium guajava  | Ref. |
Plantae | Piperaceae | Piper betle  | Ref. |
Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Rutaceae | Murraya paniculata  | Ref. |
Plantae | Saururaceae | Houttuynia cordata  | Ref. |
Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
Plantae | Verbenaceae | Lippia chevalieri | Ref. |
- | - | Baeckea frutescens L.  | Ref. |
- | - | Labiatae | Ref. |
- | - | Origanum | Ref. |
- | - | Thyme | Ref. |
- | - | Trachyspermum roxburghianum  | Ref. |
|
|
zoom in
Organism | Citrus reticulata | Reference | Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Shin, et al., Planta Med, 70, (2004), 1090.
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
---|
|