Name |
Carvacrol |
Formula |
C10H14O |
Mw |
150.10446507 |
CAS RN |
499-75-2 |
C_ID |
C00000156
, 
|
InChIKey |
RECUKUPTGUEGMW-UHFFFAOYSA-N |
InChICode |
InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3 |
SMILES |
Cc1ccc(C(C)C)cc1O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Cyprinidae | Orthodon hadai | Ref. |
Plantae | -- | Lonicera japonica  | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Annonaceae | Xylopia sericea  | Ref. |
Plantae | Apiaceae | Angelica sinensis  | Ref. |
Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
Plantae | Asteraceae | Ageratina jocotepecana | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia annua  | Ref. |
Plantae | Asteraceae | Baccharis dracunculifolia  | Ref. |
Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
Plantae | Asteraceae | Matricaria recutita  | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
Plantae | Burseraceae | Canarium album  | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Gentianaceae | Gentiana lutea  | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Labiatae | Mosla chinensis | Ref. |
Plantae | Labiatae | Ocimum basilicum  | Ref. |
Plantae | Labiatae | Origanum dubium | Ref. |
Plantae | Labiatae | Origanum vulgare  | Ref. |
Plantae | Labiatae | Perilla frutescens  | Ref. |
Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
Plantae | Labiatae | Salvia officinalis  | Ref. |
Plantae | Labiatae | Satureja thymbra  | Ref. |
Plantae | Labiatae | Thymus algeriensis | Ref. |
Plantae | Labiatae | Thymus broussonetii | Ref. |
Plantae | Labiatae | Thymus broussonetti | Ref. |
Plantae | Labiatae | Thymus capitatus  | Ref. |
Plantae | Labiatae | Thymus caramanicus | Ref. |
Plantae | Labiatae | Thymus daenensis | Ref. |
Plantae | Labiatae | Thymus magnus | Ref. |
Plantae | Labiatae | Thymus maroccanus | Ref. |
Plantae | Labiatae | Thymus piperella  | Ref. |
Plantae | Labiatae | Thymus praecos | Ref. |
Plantae | Labiatae | Thymus pubescens | Ref. |
Plantae | Labiatae | Thymus quinquecostatus | Ref. |
Plantae | Labiatae | Thymus vulgaris  | Ref. |
Plantae | Lamiaceae | Calamintha nepeta subsp. glandulosa  | Ref. |
Plantae | Lamiaceae | Coleus aromaticus  | Ref. |
Plantae | Lamiaceae | Coridothymus capitatus  | Ref. |
Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
Plantae | Lauraceae | Ocotea corymbosa | Ref. |
Plantae | Moraceae | Morus alba  | Ref. |
Plantae | Myrtaceae | Psidium guajava  | Ref. |
Plantae | Piperaceae | Piper betle  | Ref. |
Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Rutaceae | Murraya paniculata  | Ref. |
Plantae | Saururaceae | Houttuynia cordata  | Ref. |
Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
Plantae | Verbenaceae | Lippia chevalieri | Ref. |
- | - | Baeckea frutescens L.  | Ref. |
- | - | Labiatae | Ref. |
- | - | Origanum | Ref. |
- | - | Thyme | Ref. |
- | - | Trachyspermum roxburghianum  | Ref. |
|
|
zoom in
Organism | Thymus maroccanus | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|