| Name |
Isomangiferin |
| Formula |
C19H18O11 |
| Mw |
422.08491142 |
| CAS RN |
24699-16-9 |
| C_ID |
C00041015
, 
|
| InChIKey |
CDYBOKJASDEORM-SBDJAUBMNA-N |
| InChICode |
InChI=1S/C19H18O11/c20-4-11-15(26)16(27)17(28)19(30-11)13-9(24)2-8(23)12-14(25)5-1-6(21)7(22)3-10(5)29-18(12)13/h1-3,11,15-17,19-24,26-28H,4H2/t11-,15-,16+,17-,19+/m1/s1 |
| SMILES |
O=c1c2cc(O)c(O)cc2oc2c(C3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Anemarrhenaceae | Anemarrhena asphodeloides  | Ref. |
| Plantae | Aspleniaceae | Asplenium montanum Willd. | Ref. |
| Plantae | Fabaceae | Hedysarum denticulatum | Ref. |
| Plantae | Hypericaceae | Cratoxylum formosum ssp.pruniflorum  | Ref. |
| Plantae | Hypericaceae | Hypericum sampsonii | Ref. |
| Plantae | Iridaceae | Iris florentina | Ref. |
| Plantae | Polypodiaceae | Pyrrosia calvata | Ref. |
| Plantae | Polypodiaceae | Pyrrosia lingua  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia petiolosa  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia pseudocalvata | Ref. |
| Plantae | Polypodiaceae | Pyrrosia sheareri | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
|
|
zoom in
| Organism | Pyrrosia petiolosa | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|