| Name |
Zataroside A (Z,E)-alpha-Farnesene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
26560-14-5 |
| C_ID |
C00035167
, 
|
| InChIKey |
CXENHBSYCFFKJS-OXYODPPFSA-N |
| InChICode |
InChI=1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9-10,12H,1,7-8,11H2,2-5H3/b14-10-,15-12+ |
| SMILES |
C=C/C(C)=CC/C=C(C)CCC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Anthemis aciphylla | Ref. |
| Plantae | Cactaceae | Opuntia ficus-indica var.saboten  | Ref. |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|