| Name |
Friedelanol Friedelinol Friedelan-3alpha-ol |
| Formula |
C30H52O |
| Mw |
428.40181628 |
| CAS RN |
5085-72-3 |
| C_ID |
C00031793
, 
|
| InChIKey |
XCDQFROEGGNAER-VYFOYESCSA-N |
| InChICode |
InChI=1S/C30H52O/c1-20-21(31)9-10-22-27(20,5)12-11-23-28(22,6)16-18-30(8)24-19-25(2,3)13-14-26(24,4)15-17-29(23,30)7/h20-24,31H,9-19H2,1-8H3/t20-,21+,22+,23-,24+,26+,27+,28-,29+,30-/m0/s1 |
| SMILES |
C[C@H]1[C@H](O)CC[C@@H]2[C@]1(C)CC[C@H]1[C@@]2(C)CC[C@@]2(C)[C@@H]3CC(C)(C)CC[C@]3(C)CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Goniothalamus thwaitesii | Ref. |
| Plantae | Asteraceae | Chuquiraga ulicina ssp. ulicina | Ref. |
| Plantae | Asteraceae | Doellingeria scaber | Ref. |
| Plantae | Asteraceae | Eupatorium azureum | Ref. |
| Plantae | Asteraceae | Eupatorium riparium | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum thwaitesii | Ref. |
| Plantae | Celastraceae | Celastrus hindsii BENTH | Ref. |
| Plantae | Celastraceae | Euonymus japonica | Ref. |
| Plantae | Convolvulaceae | Argyreia populifolia | Ref. |
| Plantae | Convolvulaceae | Argyreia speciosa  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia antiquorum  | Ref. |
| Plantae | Euphorbiaceae | Macaranga tanarius | Ref. |
| Plantae | Hydrangeaceae | Pileostegia viburnoides var. glabrescens | Ref. |
| Plantae | Hypericaceae | Hypericum ascyron  | Ref. |
| Plantae | Moraceae | Ficus nitida | Ref. |
| Plantae | Phyllanthaceae | Bischofia javanica  | Ref. |
| Plantae | Plumbaginaceae | Plumbago zeylanica  | Ref. |
| Plantae | Polygonaceae | Polygonum bistorta  | Ref. |
| - | - | Balanops australiana | Ref. |
| - | - | Bishofia javanica | Ref. |
| - | - | Gymnaster koraiensis | Ref. |
|
|
zoom in
| Organism | Argyreia speciosa | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|